C28H42N4O3 — CID 15712326
N-[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoylamino]anilino]formamide (PubChem CID 15712326) has the molecular formula C28H42N4O3 and a molecular weight of 482.67 g/mol. Its IUPAC name is N-[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoylamino]anilino]formamide.
| Compound Name | N-[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoylamino]anilino]formamide |
|---|---|
| PubChem CID | 15712326 |
| Molecular Formula | C28H42N4O3 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.33 |
| IUPAC Name | N-[4-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butylcarbamoylamino]anilino]formamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)Nc2ccc(NNC=O)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C28H42N4O3/c1-7-27(3,4)21-11-16-25(24(19-21)28(5,6)8-2)35-18-10-9-17-29-26(34)31-22-12-14-23(15-13-22)32-30-20-33/h11-16,19-20,32H,7-10,17-18H2,1-6H3,(H,30,33)(H2,29,31,34) |
| InChIKey | AUVGCMUPUVMNCJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|