C29H44N2OS — CID 19650324
1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3,4-dimethylphenyl)thiourea (PubChem CID 19650324) has the molecular formula C29H44N2OS and a molecular weight of 468.75 g/mol. Its IUPAC name is 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3,4-dimethylphenyl)thiourea.
| Compound Name | 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 19650324 |
| Molecular Formula | C29H44N2OS |
| Molecular Weight | 468.75 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3,4-dimethylphenyl)thiourea |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=S)Nc2ccc(C)c(C)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C29H44N2OS/c1-9-28(5,6)23-14-16-26(25(20-23)29(7,8)10-2)32-18-12-11-17-30-27(33)31-24-15-13-21(3)22(4)19-24/h13-16,19-20H,9-12,17-18H2,1-8H3,(H2,30,31,33) |
| InChIKey | BDYKPBFKUGIOMT-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.75 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|