C27H39ClN2OS — CID 19650300
1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3-chlorophenyl)thiourea (PubChem CID 19650300) has the molecular formula C27H39ClN2OS and a molecular weight of 475.14 g/mol. Its IUPAC name is 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3-chlorophenyl)thiourea.
| Compound Name | 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 19650300 |
| Molecular Formula | C27H39ClN2OS |
| Molecular Weight | 475.14 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | 1-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-(3-chlorophenyl)thiourea |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=S)Nc2cccc(Cl)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C27H39ClN2OS/c1-7-26(3,4)20-14-15-24(23(18-20)27(5,6)8-2)31-17-10-9-16-29-25(32)30-22-13-11-12-21(28)19-22/h11-15,18-19H,7-10,16-17H2,1-6H3,(H2,29,30,32) |
| InChIKey | HFEJWOMFPAUINT-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.14 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|