C32H45N5O4S — CID 57019678
1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-[3-[(4-hydrazinylphenyl)sulfamoyl]phenyl]urea (PubChem CID 57019678) has the molecular formula C32H45N5O4S and a molecular weight of 595.81 g/mol. Its IUPAC name is 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-[3-[(4-hydrazinylphenyl)sulfamoyl]phenyl]urea.
| Compound Name | 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-[3-[(4-hydrazinylphenyl)sulfamoyl]phenyl]urea |
|---|---|
| PubChem CID | 57019678 |
| Molecular Formula | C32H45N5O4S |
| Molecular Weight | 595.81 g/mol |
| Exact Mass | 595.32 |
| IUPAC Name | 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-[3-[(4-hydrazinylphenyl)sulfamoyl]phenyl]urea |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)Nc2cccc(S(=O)(=O)Nc3ccc(NN)cc3)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C32H45N5O4S/c1-7-31(3,4)23-13-18-29(28(21-23)32(5,6)8-2)41-20-10-19-34-30(38)35-26-11-9-12-27(22-26)42(39,40)37-25-16-14-24(36-33)15-17-25/h9,11-18,21-22,36-37H,7-8,10,19-20,33H2,1-6H3,(H2,34,35,38) |
| InChIKey | JDUVASAZBOZNDZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 134.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.81 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|