C39H52Cl2N2O4 — CID 88752777
N-[3-[[3-(1-adamantyl)-2,2-dichloro-3-oxopropanoyl]amino]phenyl]-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide (PubChem CID 88752777) has the molecular formula C39H52Cl2N2O4 and a molecular weight of 683.76 g/mol. Its IUPAC name is N-[3-[[3-(1-adamantyl)-2,2-dichloro-3-oxopropanoyl]amino]phenyl]-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide.
| Compound Name | N-[3-[[3-(1-adamantyl)-2,2-dichloro-3-oxopropanoyl]amino]phenyl]-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 88752777 |
| Molecular Formula | C39H52Cl2N2O4 |
| Molecular Weight | 683.76 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | N-[3-[[3-(1-adamantyl)-2,2-dichloro-3-oxopropanoyl]amino]phenyl]-4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Nc2cccc(NC(=O)C(Cl)(Cl)C(=O)C34CC5CC(CC(C5)C3)C4)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C39H52Cl2N2O4/c1-7-36(3,4)28-14-15-32(31(20-28)37(5,6)8-2)47-16-10-13-33(44)42-29-11-9-12-30(21-29)43-35(46)39(40,41)34(45)38-22-25-17-26(23-38)19-27(18-25)24-38/h9,11-12,14-15,20-21,25-27H,7-8,10,13,16-19,22-24H2,1-6H3,(H,42,44)(H,43,46) |
| InChIKey | PMIRPWDWTGOAIB-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.76 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|