C33H46Cl2N2O4 — CID 7072431
(2S)-N-[5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-chloro-4,4-dimethyl-3-oxopentanamide (PubChem CID 7072431) has the molecular formula C33H46Cl2N2O4 and a molecular weight of 605.65 g/mol. Its IUPAC name is (2S)-N-[5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-chloro-4,4-dimethyl-3-oxopentanamide.
| Compound Name | (2S)-N-[5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-chloro-4,4-dimethyl-3-oxopentanamide |
|---|---|
| PubChem CID | 7072431 |
| Molecular Formula | C33H46Cl2N2O4 |
| Molecular Weight | 605.65 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | (2S)-N-[5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-2-chloro-4,4-dimethyl-3-oxopentanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Nc2ccc(Cl)c(NC(=O)[C@@H](Cl)C(=O)C(C)(C)C)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C33H46Cl2N2O4/c1-10-32(6,7)21-14-17-26(23(19-21)33(8,9)11-2)41-18-12-13-27(38)36-22-15-16-24(34)25(20-22)37-30(40)28(35)29(39)31(3,4)5/h14-17,19-20,28H,10-13,18H2,1-9H3,(H,36,38)(H,37,40)/t28-/m0/s1 |
| InChIKey | PGTKBBBKIKZMMD-NDEPHWFRSA-N |
| XLogP | 8.67 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.65 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|