C52H61ClN2O7S — CID 58613083
N-[5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-4,4-dimethyl-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenyl]pentanamide (PubChem CID 58613083) has the molecular formula C52H61ClN2O7S and a molecular weight of 893.59 g/mol. Its IUPAC name is N-[5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-4,4-dimethyl-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenyl]pentanamide.
| Compound Name | N-[5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-4,4-dimethyl-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenyl]pentanamide |
|---|---|
| PubChem CID | 58613083 |
| Molecular Formula | C52H61ClN2O7S |
| Molecular Weight | 893.59 g/mol |
| Exact Mass | 892.39 |
| IUPAC Name | N-[5-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-chlorophenyl]-4,4-dimethyl-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenyl]pentanamide |
| SMILES | CCC(C)(C)c1ccc(OCCCC(=O)Nc2ccc(Cl)c(NC(=O)C(C(=O)C(C)(C)C)c3ccc(S(=O)(=O)c4ccc(OCc5ccccc5)cc4)cc3)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C52H61ClN2O7S/c1-10-51(6,7)37-21-30-45(42(32-37)52(8,9)11-2)61-31-15-18-46(56)54-38-22-29-43(53)44(33-38)55-49(58)47(48(57)50(3,4)5)36-19-25-40(26-20-36)63(59,60)41-27-23-39(24-28-41)62-34-35-16-13-12-14-17-35/h12-14,16-17,19-30,32-33,47H,10-11,15,18,31,34H2,1-9H3,(H,54,56)(H,55,58) |
| InChIKey | YIBGKJHUDMNOLG-UHFFFAOYSA-N |
| XLogP | 12.26 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.59 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|