C44H45ClN2O8S — CID 59929453
N-[2-chloro-5-[4-(2,4-dimethylphenoxy)butanoylamino]phenyl]-4,4-dimethyl-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]pentanamide (PubChem CID 59929453) has the molecular formula C44H45ClN2O8S and a molecular weight of 797.37 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(2,4-dimethylphenoxy)butanoylamino]phenyl]-4,4-dimethyl-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]pentanamide.
| Compound Name | N-[2-chloro-5-[4-(2,4-dimethylphenoxy)butanoylamino]phenyl]-4,4-dimethyl-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]pentanamide |
|---|---|
| PubChem CID | 59929453 |
| Molecular Formula | C44H45ClN2O8S |
| Molecular Weight | 797.37 g/mol |
| Exact Mass | 796.26 |
| IUPAC Name | N-[2-chloro-5-[4-(2,4-dimethylphenoxy)butanoylamino]phenyl]-4,4-dimethyl-3-oxo-2-[4-(4-phenylmethoxyphenyl)sulfonylphenoxy]pentanamide |
| SMILES | Cc1ccc(OCCCC(=O)Nc2ccc(Cl)c(NC(=O)C(Oc3ccc(S(=O)(=O)c4ccc(OCc5ccccc5)cc4)cc3)C(=O)C(C)(C)C)c2)c(C)c1 |
| InChI | InChI=1S/C44H45ClN2O8S/c1-29-13-24-39(30(2)26-29)53-25-9-12-40(48)46-32-14-23-37(45)38(27-32)47-43(50)41(42(49)44(3,4)5)55-34-17-21-36(22-18-34)56(51,52)35-19-15-33(16-20-35)54-28-31-10-7-6-8-11-31/h6-8,10-11,13-24,26-27,41H,9,12,25,28H2,1-5H3,(H,46,48)(H,47,50) |
| InChIKey | OTIUGKDASIHYDG-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.37 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|