C41H53ClN6O4 — CID 88809239
N-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-4,4-dimethyl-2-[5-(2-methylphenyl)tetrazol-2-yl]-3-oxopentanamide (PubChem CID 88809239) has the molecular formula C41H53ClN6O4 and a molecular weight of 729.37 g/mol. Its IUPAC name is N-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-4,4-dimethyl-2-[5-(2-methylphenyl)tetrazol-2-yl]-3-oxopentanamide.
| Compound Name | N-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-4,4-dimethyl-2-[5-(2-methylphenyl)tetrazol-2-yl]-3-oxopentanamide |
|---|---|
| PubChem CID | 88809239 |
| Molecular Formula | C41H53ClN6O4 |
| Molecular Weight | 729.37 g/mol |
| Exact Mass | 728.38 |
| IUPAC Name | N-[3-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]phenyl]-2-chloro-4,4-dimethyl-2-[5-(2-methylphenyl)tetrazol-2-yl]-3-oxopentanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1cccc(NC(=O)C(Cl)(C(=O)C(C)(C)C)n2nnc(-c3ccccc3C)n2)c1 |
| InChI | InChI=1S/C41H53ClN6O4/c1-12-32(52-33-23-22-27(39(8,9)13-2)24-31(33)40(10,11)14-3)35(49)43-28-19-17-20-29(25-28)44-37(51)41(42,36(50)38(5,6)7)48-46-34(45-47-48)30-21-16-15-18-26(30)4/h15-25,32H,12-14H2,1-11H3,(H,43,49)(H,44,51) |
| InChIKey | BHTBOELVSJSDOF-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.37 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|