C48H57ClN4O8 — CID 22764770
N-[5-[3-anilino-2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-4-yl)-2-chloro-3-oxopropanoyl]-2-methoxyphenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide (PubChem CID 22764770) has the molecular formula C48H57ClN4O8 and a molecular weight of 853.46 g/mol. Its IUPAC name is N-[5-[3-anilino-2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-4-yl)-2-chloro-3-oxopropanoyl]-2-methoxyphenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide.
| Compound Name | N-[5-[3-anilino-2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-4-yl)-2-chloro-3-oxopropanoyl]-2-methoxyphenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
|---|---|
| PubChem CID | 22764770 |
| Molecular Formula | C48H57ClN4O8 |
| Molecular Weight | 853.46 g/mol |
| Exact Mass | 852.39 |
| IUPAC Name | N-[5-[3-anilino-2-(3-benzyl-4-ethoxy-2,5-dioxoimidazolidin-4-yl)-2-chloro-3-oxopropanoyl]-2-methoxyphenyl]-2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanamide |
| SMILES | CCOC1(C(Cl)(C(=O)Nc2ccccc2)C(=O)c2ccc(OC)c(NC(=O)C(CC)Oc3ccc(C(C)(C)CC)cc3C(C)(C)CC)c2)C(=O)NC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C48H57ClN4O8/c1-10-37(61-38-27-25-33(45(5,6)11-2)29-35(38)46(7,8)12-3)41(55)51-36-28-32(24-26-39(36)59-9)40(54)47(49,42(56)50-34-22-18-15-19-23-34)48(60-13-4)43(57)52-44(58)53(48)30-31-20-16-14-17-21-31/h14-29,37H,10-13,30H2,1-9H3,(H,50,56)(H,51,55)(H,52,57,58) |
| InChIKey | RUSRXXXVOKOHJI-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.46 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|