C16H21F3N6S — CID 162548895
4-(1H-imidazol-2-yldiazenyl)-1-N,1-N-di(propan-2-yl)-3-N-(trifluoromethylsulfanyl)benzene-1,3-diamine (PubChem CID 162548895) has the molecular formula C16H21F3N6S and a molecular weight of 386.45 g/mol. Its IUPAC name is 4-(1H-imidazol-2-yldiazenyl)-1-N,1-N-di(propan-2-yl)-3-N-(trifluoromethylsulfanyl)benzene-1,3-diamine.
| Compound Name | 4-(1H-imidazol-2-yldiazenyl)-1-N,1-N-di(propan-2-yl)-3-N-(trifluoromethylsulfanyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 162548895 |
| Molecular Formula | C16H21F3N6S |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 4-(1H-imidazol-2-yldiazenyl)-1-N,1-N-di(propan-2-yl)-3-N-(trifluoromethylsulfanyl)benzene-1,3-diamine |
| SMILES | CC(C)N(c1ccc(/N=N/c2ncc[nH]2)c(NSC(F)(F)F)c1)C(C)C |
| InChI | InChI=1S/C16H21F3N6S/c1-10(2)25(11(3)4)12-5-6-13(22-23-15-20-7-8-21-15)14(9-12)24-26-16(17,18)19/h5-11,24H,1-4H3,(H,20,21)/b23-22+ |
| InChIKey | DQPBXWMFFWZYQW-GHVJWSGMSA-N |
| XLogP | 6.03 |
| TPSA | 68.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|