C13H18F3N — CID 146165674
N,N-di(propan-2-yl)-4-(trifluoromethyl)aniline (PubChem CID 146165674) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is N,N-di(propan-2-yl)-4-(trifluoromethyl)aniline.
| Compound Name | N,N-di(propan-2-yl)-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 146165674 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N,N-di(propan-2-yl)-4-(trifluoromethyl)aniline |
| SMILES | CC(C)N(c1ccc(C(F)(F)F)cc1)C(C)C |
| InChI | InChI=1S/C13H18F3N/c1-9(2)17(10(3)4)12-7-5-11(6-8-12)13(14,15)16/h5-10H,1-4H3 |
| InChIKey | VQNZVNBMTKEAJI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |