C16H17ClF3N5O2S — CID 20650745
N-[2-[(5-chloro-2-pyridinyl)diazenyl]-5-(diethylamino)phenyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 20650745) has the molecular formula C16H17ClF3N5O2S and a molecular weight of 435.86 g/mol. Its IUPAC name is N-[2-[(5-chloro-2-pyridinyl)diazenyl]-5-(diethylamino)phenyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[2-[(5-chloro-2-pyridinyl)diazenyl]-5-(diethylamino)phenyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 20650745 |
| Molecular Formula | C16H17ClF3N5O2S |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[2-[(5-chloro-2-pyridinyl)diazenyl]-5-(diethylamino)phenyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(Cl)cn2)c(NS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H17ClF3N5O2S/c1-3-25(4-2)12-6-7-13(22-23-15-8-5-11(17)10-21-15)14(9-12)24-28(26,27)16(18,19)20/h5-10,24H,3-4H2,1-2H3/b23-22+ |
| InChIKey | VZZOMUKNBJEENT-GHVJWSGMSA-N |
| XLogP | 5.26 |
| TPSA | 87.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|