C17H19ClF3N5O2S — CID 20650715
4-[(5-chloro-2-pyridinyl)diazenyl]-3-[[difluoromethoxy-(fluoromethyl)-oxo-λ6-sulfanylidene]amino]-N,N-diethylaniline (PubChem CID 20650715) has the molecular formula C17H19ClF3N5O2S and a molecular weight of 449.89 g/mol. Its IUPAC name is 4-[(5-chloro-2-pyridinyl)diazenyl]-3-[[difluoromethoxy-(fluoromethyl)-oxo-λ6-sulfanylidene]amino]-N,N-diethylaniline.
| Compound Name | 4-[(5-chloro-2-pyridinyl)diazenyl]-3-[[difluoromethoxy-(fluoromethyl)-oxo-λ6-sulfanylidene]amino]-N,N-diethylaniline |
|---|---|
| PubChem CID | 20650715 |
| Molecular Formula | C17H19ClF3N5O2S |
| Molecular Weight | 449.89 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 4-[(5-chloro-2-pyridinyl)diazenyl]-3-[[difluoromethoxy-(fluoromethyl)-oxo-λ6-sulfanylidene]amino]-N,N-diethylaniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(Cl)cn2)c(N=S(=O)(CF)OC(F)F)c1 |
| InChI | InChI=1S/C17H19ClF3N5O2S/c1-3-26(4-2)13-6-7-14(23-24-16-8-5-12(18)10-22-16)15(9-13)25-29(27,11-19)28-17(20)21/h5-10,17H,3-4,11H2,1-2H3/b24-23+ |
| InChIKey | QXLDEOPWEKBVMK-WCWDXBQESA-N |
| XLogP | 6.18 |
| TPSA | 79.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.89 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|