C16H17Cl2N4O3S- — CID 23260744
4-[[2-amino-4-(diethylamino)phenyl]diazenyl]-2,5-dichlorobenzenesulfonate (PubChem CID 23260744) has the molecular formula C16H17Cl2N4O3S- and a molecular weight of 416.31 g/mol. Its IUPAC name is 4-[[2-amino-4-(diethylamino)phenyl]diazenyl]-2,5-dichlorobenzenesulfonate.
| Compound Name | 4-[[2-amino-4-(diethylamino)phenyl]diazenyl]-2,5-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 23260744 |
| Molecular Formula | C16H17Cl2N4O3S- |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 4-[[2-amino-4-(diethylamino)phenyl]diazenyl]-2,5-dichlorobenzenesulfonate |
| SMILES | CCN(CC)c1ccc(/N=N/c2cc(Cl)c(S(=O)(=O)[O-])cc2Cl)c(N)c1 |
| InChI | InChI=1S/C16H18Cl2N4O3S/c1-3-22(4-2)10-5-6-14(13(19)7-10)20-21-15-8-12(18)16(9-11(15)17)26(23,24)25/h5-9H,3-4,19H2,1-2H3,(H,23,24,25)/p-1/b21-20+ |
| InChIKey | KZQOUMBSDWFVFL-QZQOTICOSA-M |
| XLogP | 4.74 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|