C19H21N5O2 — CID 132564493
3-[(2,4-diaminophenyl)diazenyl]-7-(diethylamino)chromen-2-one (PubChem CID 132564493) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 3-[(2,4-diaminophenyl)diazenyl]-7-(diethylamino)chromen-2-one.
| Compound Name | 3-[(2,4-diaminophenyl)diazenyl]-7-(diethylamino)chromen-2-one |
|---|---|
| PubChem CID | 132564493 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 3-[(2,4-diaminophenyl)diazenyl]-7-(diethylamino)chromen-2-one |
| SMILES | CCN(CC)c1ccc2cc(/N=N/c3ccc(N)cc3N)c(=O)oc2c1 |
| InChI | InChI=1S/C19H21N5O2/c1-3-24(4-2)14-7-5-12-9-17(19(25)26-18(12)11-14)23-22-16-8-6-13(20)10-15(16)21/h5-11H,3-4,20-21H2,1-2H3/b23-22+ |
| InChIKey | DPRMYUKZIVYJQE-GHVJWSGMSA-N |
| XLogP | 4.22 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|