C16H19N2O2S- — CID 166593957
[(E,3S)-3-[7-(diethylamino)-2-oxochromen-3-yl]-3-sulfanylprop-1-enyl]azanide (PubChem CID 166593957) has the molecular formula C16H19N2O2S- and a molecular weight of 303.41 g/mol. Its IUPAC name is [(E,3S)-3-[7-(diethylamino)-2-oxochromen-3-yl]-3-sulfanylprop-1-enyl]azanide.
| Compound Name | [(E,3S)-3-[7-(diethylamino)-2-oxochromen-3-yl]-3-sulfanylprop-1-enyl]azanide |
|---|---|
| PubChem CID | 166593957 |
| Molecular Formula | C16H19N2O2S- |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | [(E,3S)-3-[7-(diethylamino)-2-oxochromen-3-yl]-3-sulfanylprop-1-enyl]azanide |
| SMILES | CCN(CC)c1ccc2cc([C@@H](S)/C=C/[NH-])c(=O)oc2c1 |
| InChI | InChI=1S/C16H19N2O2S/c1-3-18(4-2)12-6-5-11-9-13(15(21)7-8-17)16(19)20-14(11)10-12/h5-10,15,17,21H,3-4H2,1-2H3/q-1/b8-7+/t15-/m0/s1 |
| InChIKey | CNEKZLKJAXVQAP-KIUWMYQTSA-N |
| XLogP | 4.18 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|