C14H14Cl2N2NiO6S2 — CID 101303855
bis(4-amino-2-chloro-5-methylbenzenesulfonate);nickel(2+) (PubChem CID 101303855) has the molecular formula C14H14Cl2N2NiO6S2 and a molecular weight of 500.01 g/mol. Its IUPAC name is bis(4-amino-2-chloro-5-methylbenzenesulfonate);nickel(2+).
| Compound Name | bis(4-amino-2-chloro-5-methylbenzenesulfonate);nickel(2+) |
|---|---|
| PubChem CID | 101303855 |
| Molecular Formula | C14H14Cl2N2NiO6S2 |
| Molecular Weight | 500.01 g/mol |
| Exact Mass | 497.90 |
| IUPAC Name | bis(4-amino-2-chloro-5-methylbenzenesulfonate);nickel(2+) |
| SMILES | Cc1cc(S(=O)(=O)[O-])c(Cl)cc1N.Cc1cc(S(=O)(=O)[O-])c(Cl)cc1N.[Ni+2] |
| InChI | InChI=1S/2C7H8ClNO3S.Ni/c2*1-4-2-7(13(10,11)12)5(8)3-6(4)9;/h2*2-3H,9H2,1H3,(H,10,11,12);/q;;+2/p-2 |
| InChIKey | ARJOSSMZKBAMGO-UHFFFAOYSA-L |
| XLogP | 2.27 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.01 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|