About bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+)
bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+) (PubChem CID 101303858) has the molecular formula C14H14Cl2N2NiO6S2
and a molecular weight of 500.01 g/mol. Its IUPAC name is bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+).
Molecular Properties
| Compound Name | bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+) |
| PubChem CID | 101303858 |
| Molecular Formula | C14H14Cl2N2NiO6S2 |
| Molecular Weight | 500.01 g/mol |
| Exact Mass | 497.90 |
| IUPAC Name | bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+) |
| SMILES | Cc1cc(S(=O)(=O)[O-])cc(Cl)c1N.Cc1cc(S(=O)(=O)[O-])cc(Cl)c1N.[Ni+2] |
| InChI | InChI=1S/2C7H8ClNO3S.Ni/c2*1-4-2-5(13(10,11)12)3-6(8)7(4)9;/h2*2-3H,9H2,1H3,(H,10,11,12);/q;;+2/p-2 |
| InChIKey | UENULNFCHZKSRI-UHFFFAOYSA-L |
| XLogP | 2.27 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.01 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+)?
The IUPAC name of bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+) (CID 101303858) is bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+).
What is the SMILES notation for bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+)?
The canonical SMILES for bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+) is Cc1cc(S(=O)(=O)[O-])cc(Cl)c1N.Cc1cc(S(=O)(=O)[O-])cc(Cl)c1N.[Ni+2].
What is the InChIKey of bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+)?
The InChIKey is UENULNFCHZKSRI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H8ClNO3S.Ni/c2*1-4-2-5(13(10,11)12)3-6(8)7(4)9;/h2*2-3H,9H2,1H3,(H,10,11,12);/q;;+2/p-2.
What are the key properties of bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+)?
bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+) has a molecular weight of 500.01 g/mol, XLogP of 2.27, 2 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-amino-3-chloro-5-methylbenzenesulfonate);nickel(2+) is sourced from PubChem (CID 101303858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).