sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate

C10H15N2NaO4S2 — CID 176656196

IUPACsodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate
SMILESCCN(CC)c1ccc(N)c(SOS(=O)(=O)[O-])c1.[Na+]
InChIInChI=1S/C10H16N2O4S2.Na/c1-3-12(4-2)8-5-6-9(11)10(7-8)17-16-18(13,14)15;/h5-7H,3-4,11H2,1-2H3,(H,13,14,15);/q;+1/p-1
InChIKeyYAYQOXDWFRAOCN-UHFFFAOYSA-M
MW314.36 g/mol
LogP-1.40
Rot. Bonds6

About sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate

sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate (PubChem CID 176656196) has the molecular formula C10H15N2NaO4S2 and a molecular weight of 314.36 g/mol. Its IUPAC name is sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate.

Molecular Properties

Compound Namesodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate
PubChem CID176656196
Molecular FormulaC10H15N2NaO4S2
Molecular Weight314.36 g/mol
Exact Mass314.04
IUPAC Namesodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate
SMILESCCN(CC)c1ccc(N)c(SOS(=O)(=O)[O-])c1.[Na+]
InChIInChI=1S/C10H16N2O4S2.Na/c1-3-12(4-2)8-5-6-9(11)10(7-8)17-16-18(13,14)15;/h5-7H,3-4,11H2,1-2H3,(H,13,14,15);/q;+1/p-1
InChIKeyYAYQOXDWFRAOCN-UHFFFAOYSA-M
XLogP-1.40
TPSA95.69 Ų
H-Bond Donors1
H-Bond Acceptors7
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.36
LogP ≤ 5-1.40
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'}

Analyze sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate?
The IUPAC name of sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate (CID 176656196) is sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate.
What is the SMILES notation for sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate?
The canonical SMILES for sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate is CCN(CC)c1ccc(N)c(SOS(=O)(=O)[O-])c1.[Na+].
What is the InChIKey of sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate?
The InChIKey is YAYQOXDWFRAOCN-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H16N2O4S2.Na/c1-3-12(4-2)8-5-6-9(11)10(7-8)17-16-18(13,14)15;/h5-7H,3-4,11H2,1-2H3,(H,13,14,15);/q;+1/p-1.
What are the key properties of sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate?
sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate has a molecular weight of 314.36 g/mol, XLogP of -1.40, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate is sourced from PubChem (CID 176656196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).