C10H15N2NaO4S2 — CID 176656196
sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate (PubChem CID 176656196) has the molecular formula C10H15N2NaO4S2 and a molecular weight of 314.36 g/mol. Its IUPAC name is sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate.
| Compound Name | sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate |
|---|---|
| PubChem CID | 176656196 |
| Molecular Formula | C10H15N2NaO4S2 |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | sodium [2-amino-5-(diethylamino)phenyl]sulfanyl sulfate |
| SMILES | CCN(CC)c1ccc(N)c(SOS(=O)(=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C10H16N2O4S2.Na/c1-3-12(4-2)8-5-6-9(11)10(7-8)17-16-18(13,14)15;/h5-7H,3-4,11H2,1-2H3,(H,13,14,15);/q;+1/p-1 |
| InChIKey | YAYQOXDWFRAOCN-UHFFFAOYSA-M |
| XLogP | -1.40 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|