C14H26N4O4S2 — CID 88656162
N-[1-[2-amino-5-(diethylamino)phenyl]-1-(methanesulfonamido)ethyl]methanesulfonamide (PubChem CID 88656162) has the molecular formula C14H26N4O4S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[1-[2-amino-5-(diethylamino)phenyl]-1-(methanesulfonamido)ethyl]methanesulfonamide.
| Compound Name | N-[1-[2-amino-5-(diethylamino)phenyl]-1-(methanesulfonamido)ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 88656162 |
| Molecular Formula | C14H26N4O4S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[1-[2-amino-5-(diethylamino)phenyl]-1-(methanesulfonamido)ethyl]methanesulfonamide |
| SMILES | CCN(CC)c1ccc(N)c(C(C)(NS(C)(=O)=O)NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H26N4O4S2/c1-6-18(7-2)11-8-9-13(15)12(10-11)14(3,16-23(4,19)20)17-24(5,21)22/h8-10,16-17H,6-7,15H2,1-5H3 |
| InChIKey | OWZKIAXQRDZEHH-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|