C33H55N7O2S — CID 70270902
N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;4-N,4-N-diethylbenzene-1,4-diamine;4-N,4-N-diethyl-2-methylbenzene-1,4-diamine (PubChem CID 70270902) has the molecular formula C33H55N7O2S and a molecular weight of 613.92 g/mol. Its IUPAC name is N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;4-N,4-N-diethylbenzene-1,4-diamine;4-N,4-N-diethyl-2-methylbenzene-1,4-diamine.
| Compound Name | N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;4-N,4-N-diethylbenzene-1,4-diamine;4-N,4-N-diethyl-2-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 70270902 |
| Molecular Formula | C33H55N7O2S |
| Molecular Weight | 613.92 g/mol |
| Exact Mass | 613.41 |
| IUPAC Name | N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;4-N,4-N-diethylbenzene-1,4-diamine;4-N,4-N-diethyl-2-methylbenzene-1,4-diamine |
| SMILES | CCN(CC)c1ccc(N)c(C)c1.CCN(CC)c1ccc(N)cc1.CCN(c1ccc(N)c(C)c1)C(C)NS(C)(=O)=O |
| InChI | InChI=1S/C12H21N3O2S.C11H18N2.C10H16N2/c1-5-15(10(3)14-18(4,16)17)11-6-7-12(13)9(2)8-11;1-4-13(5-2)10-6-7-11(12)9(3)8-10;1-3-12(4-2)10-7-5-9(11)6-8-10/h6-8,10,14H,5,13H2,1-4H3;6-8H,4-5,12H2,1-3H3;5-8H,3-4,11H2,1-2H3 |
| InChIKey | OOPCPULXFJKKQK-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 133.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.92 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|