C12H23N3O5S2 — CID 70415241
N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfurous acid (PubChem CID 70415241) has the molecular formula C12H23N3O5S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfurous acid.
| Compound Name | N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfurous acid |
|---|---|
| PubChem CID | 70415241 |
| Molecular Formula | C12H23N3O5S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;sulfurous acid |
| SMILES | CCN(c1ccc(N)c(C)c1)C(C)NS(C)(=O)=O.O=S(O)O |
| InChI | InChI=1S/C12H21N3O2S.H2O3S/c1-5-15(10(3)14-18(4,16)17)11-6-7-12(13)9(2)8-11;1-4(2)3/h6-8,10,14H,5,13H2,1-4H3;(H2,1,2,3) |
| InChIKey | JCTMZNBHFBJYCK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|