C30H34BN3O5S — CID 88501085
N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;benzo[a]anthracen-1-yloxyboronic acid (PubChem CID 88501085) has the molecular formula C30H34BN3O5S and a molecular weight of 559.50 g/mol. Its IUPAC name is N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;benzo[a]anthracen-1-yloxyboronic acid.
| Compound Name | N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;benzo[a]anthracen-1-yloxyboronic acid |
|---|---|
| PubChem CID | 88501085 |
| Molecular Formula | C30H34BN3O5S |
| Molecular Weight | 559.50 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | N-[1-(4-amino-N-ethyl-3-methylanilino)ethyl]methanesulfonamide;benzo[a]anthracen-1-yloxyboronic acid |
| SMILES | CCN(c1ccc(N)c(C)c1)C(C)NS(C)(=O)=O.OB(O)Oc1cccc2ccc3cc4ccccc4cc3c12 |
| InChI | InChI=1S/C18H13BO3.C12H21N3O2S/c20-19(21)22-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17;1-5-15(10(3)14-18(4,16)17)11-6-7-12(13)9(2)8-11/h1-11,20-21H;6-8,10,14H,5,13H2,1-4H3 |
| InChIKey | BSYXNIGUFNAWBI-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 125.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|