C22H18N6O — CID 175169773
2-N-(benzo[a]anthracen-1-yloxymethyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 175169773) has the molecular formula C22H18N6O and a molecular weight of 382.43 g/mol. Its IUPAC name is 2-N-(benzo[a]anthracen-1-yloxymethyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(benzo[a]anthracen-1-yloxymethyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 175169773 |
| Molecular Formula | C22H18N6O |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 2-N-(benzo[a]anthracen-1-yloxymethyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(NCOc2cccc3ccc4cc5ccccc5cc4c23)n1 |
| InChI | InChI=1S/C22H18N6O/c23-20-26-21(24)28-22(27-20)25-12-29-18-7-3-6-13-8-9-16-10-14-4-1-2-5-15(14)11-17(16)19(13)18/h1-11H,12H2,(H5,23,24,25,26,27,28) |
| InChIKey | MKBUDNFGQDJSDI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|