C20H28CaN2O6S2 — CID 102504056
calcium bis(3-(diethylamino)benzenesulfonate) (PubChem CID 102504056) has the molecular formula C20H28CaN2O6S2 and a molecular weight of 496.66 g/mol. Its IUPAC name is calcium bis(3-(diethylamino)benzenesulfonate).
| Compound Name | calcium bis(3-(diethylamino)benzenesulfonate) |
|---|---|
| PubChem CID | 102504056 |
| Molecular Formula | C20H28CaN2O6S2 |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | calcium bis(3-(diethylamino)benzenesulfonate) |
| SMILES | CCN(CC)c1cccc(S(=O)(=O)[O-])c1.CCN(CC)c1cccc(S(=O)(=O)[O-])c1.[Ca+2] |
| InChI | InChI=1S/2C10H15NO3S.Ca/c2*1-3-11(4-2)9-6-5-7-10(8-9)15(12,13)14;/h2*5-8H,3-4H2,1-2H3,(H,12,13,14);/q;;+2/p-2 |
| InChIKey | BWBXAOGIADRUGM-UHFFFAOYSA-L |
| XLogP | 2.49 |
| TPSA | 120.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|