C18H30LiNO4S — CID 58502699
lithium 3-[hexan-2-yl(1-hydroxyhexan-2-yl)amino]benzenesulfonate (PubChem CID 58502699) has the molecular formula C18H30LiNO4S and a molecular weight of 363.45 g/mol. Its IUPAC name is lithium 3-[hexan-2-yl(1-hydroxyhexan-2-yl)amino]benzenesulfonate.
| Compound Name | lithium 3-[hexan-2-yl(1-hydroxyhexan-2-yl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 58502699 |
| Molecular Formula | C18H30LiNO4S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | lithium 3-[hexan-2-yl(1-hydroxyhexan-2-yl)amino]benzenesulfonate |
| SMILES | CCCCC(C)N(c1cccc(S(=O)(=O)[O-])c1)C(CO)CCCC.[Li+] |
| InChI | InChI=1S/C18H31NO4S.Li/c1-4-6-9-15(3)19(17(14-20)10-7-5-2)16-11-8-12-18(13-16)24(21,22)23;/h8,11-13,15,17,20H,4-7,9-10,14H2,1-3H3,(H,21,22,23);/q;+1/p-1 |
| InChIKey | IZICESPCJJVGSN-UHFFFAOYSA-M |
| XLogP | 0.53 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|