C20H34KNO7S — CID 59343946
potassium 3-[bis(3-butoxy-2-hydroxypropyl)amino]benzenesulfonate (PubChem CID 59343946) has the molecular formula C20H34KNO7S and a molecular weight of 471.66 g/mol. Its IUPAC name is potassium 3-[bis(3-butoxy-2-hydroxypropyl)amino]benzenesulfonate.
| Compound Name | potassium 3-[bis(3-butoxy-2-hydroxypropyl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 59343946 |
| Molecular Formula | C20H34KNO7S |
| Molecular Weight | 471.66 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | potassium 3-[bis(3-butoxy-2-hydroxypropyl)amino]benzenesulfonate |
| SMILES | CCCCOCC(O)CN(CC(O)COCCCC)c1cccc(S(=O)(=O)[O-])c1.[K+] |
| InChI | InChI=1S/C20H35NO7S.K/c1-3-5-10-27-15-18(22)13-21(14-19(23)16-28-11-6-4-2)17-8-7-9-20(12-17)29(24,25)26;/h7-9,12,18-19,22-23H,3-6,10-11,13-16H2,1-2H3,(H,24,25,26);/q;+1/p-1 |
| InChIKey | QWYPMCSFIHQMMQ-UHFFFAOYSA-M |
| XLogP | -1.24 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.66 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|