C22H40N2O4 — CID 101292349
1-butoxy-3-[[3-[[(3-butoxy-2-hydroxypropyl)amino]methyl]phenyl]methylamino]propan-2-ol (PubChem CID 101292349) has the molecular formula C22H40N2O4 and a molecular weight of 396.57 g/mol. Its IUPAC name is 1-butoxy-3-[[3-[[(3-butoxy-2-hydroxypropyl)amino]methyl]phenyl]methylamino]propan-2-ol.
| Compound Name | 1-butoxy-3-[[3-[[(3-butoxy-2-hydroxypropyl)amino]methyl]phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 101292349 |
| Molecular Formula | C22H40N2O4 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 1-butoxy-3-[[3-[[(3-butoxy-2-hydroxypropyl)amino]methyl]phenyl]methylamino]propan-2-ol |
| SMILES | CCCCOCC(O)CNCc1cccc(CNCC(O)COCCCC)c1 |
| InChI | InChI=1S/C22H40N2O4/c1-3-5-10-27-17-21(25)15-23-13-19-8-7-9-20(12-19)14-24-16-22(26)18-28-11-6-4-2/h7-9,12,21-26H,3-6,10-11,13-18H2,1-2H3 |
| InChIKey | OGESQUJKSXXCOJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|