C20H35NO7S — CID 59343899
3-[bis(3-butoxy-2-hydroxypropyl)amino]benzenesulfonic acid (PubChem CID 59343899) has the molecular formula C20H35NO7S and a molecular weight of 433.57 g/mol. Its IUPAC name is 3-[bis(3-butoxy-2-hydroxypropyl)amino]benzenesulfonic acid.
| Compound Name | 3-[bis(3-butoxy-2-hydroxypropyl)amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 59343899 |
| Molecular Formula | C20H35NO7S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 3-[bis(3-butoxy-2-hydroxypropyl)amino]benzenesulfonic acid |
| SMILES | CCCCOCC(O)CN(CC(O)COCCCC)c1cccc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C20H35NO7S/c1-3-5-10-27-15-18(22)13-21(14-19(23)16-28-11-6-4-2)17-8-7-9-20(12-17)29(24,25)26/h7-9,12,18-19,22-23H,3-6,10-11,13-16H2,1-2H3,(H,24,25,26) |
| InChIKey | SZHLIUCUFXAGRG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|