About 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline
3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline (PubChem CID 145022587) has the molecular formula C23H36N2S
and a molecular weight of 372.62 g/mol. Its IUPAC name is 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline.
Molecular Properties
| Compound Name | 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline |
| PubChem CID | 145022587 |
| Molecular Formula | C23H36N2S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline |
| SMILES | CCN(CC)c1cccc(S(C)(CC)c2cccc(N(CC)CC)c2)c1 |
| InChI | InChI=1S/C23H36N2S/c1-7-24(8-2)20-14-12-16-22(18-20)26(6,11-5)23-17-13-15-21(19-23)25(9-3)10-4/h12-19H,7-11H2,1-6H3 |
| InChIKey | VAFAANJDCMJZCZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline?
The IUPAC name of 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline (CID 145022587) is 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline.
What is the SMILES notation for 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline?
The canonical SMILES for 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline is CCN(CC)c1cccc(S(C)(CC)c2cccc(N(CC)CC)c2)c1.
What is the InChIKey of 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline?
The InChIKey is VAFAANJDCMJZCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36N2S/c1-7-24(8-2)20-14-12-16-22(18-20)26(6,11-5)23-17-13-15-21(19-23)25(9-3)10-4/h12-19H,7-11H2,1-6H3.
What are the key properties of 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline?
3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline has a molecular weight of 372.62 g/mol, XLogP of 6.25, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[3-(diethylamino)phenyl]-ethyl-methyl-λ4-sulfanyl]-N,N-diethylaniline is sourced from PubChem (CID 145022587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).