C12H20N2 — CID 67930616
1-N,3-N,3-N-triethylbenzene-1,3-diamine (PubChem CID 67930616) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-N,3-N,3-N-triethylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N,3-N-triethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 67930616 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-N,3-N,3-N-triethylbenzene-1,3-diamine |
| SMILES | CCNc1cccc(N(CC)CC)c1 |
| InChI | InChI=1S/C12H20N2/c1-4-13-11-8-7-9-12(10-11)14(5-2)6-3/h7-10,13H,4-6H2,1-3H3 |
| InChIKey | XEOHXAGSQXJEMA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |