C18H19F3N8O2S — CID 20650765
[N-[5-(diethylamino)-2-[(1-ethyl-4,5-diisocyanoimidazol-2-yl)diazenyl]phenyl]-S-(difluoromethyl)sulfonimidoyl] hypofluorite (PubChem CID 20650765) has the molecular formula C18H19F3N8O2S and a molecular weight of 468.47 g/mol. Its IUPAC name is [N-[5-(diethylamino)-2-[(1-ethyl-4,5-diisocyanoimidazol-2-yl)diazenyl]phenyl]-S-(difluoromethyl)sulfonimidoyl] hypofluorite.
| Compound Name | [N-[5-(diethylamino)-2-[(1-ethyl-4,5-diisocyanoimidazol-2-yl)diazenyl]phenyl]-S-(difluoromethyl)sulfonimidoyl] hypofluorite |
|---|---|
| PubChem CID | 20650765 |
| Molecular Formula | C18H19F3N8O2S |
| Molecular Weight | 468.47 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | [N-[5-(diethylamino)-2-[(1-ethyl-4,5-diisocyanoimidazol-2-yl)diazenyl]phenyl]-S-(difluoromethyl)sulfonimidoyl] hypofluorite |
| SMILES | [C-]#[N+]c1nc(/N=N/c2ccc(N(CC)CC)cc2N=S(=O)(OF)C(F)F)n(CC)c1[N+]#[C-] |
| InChI | InChI=1S/C18H19F3N8O2S/c1-6-28(7-2)12-9-10-13(14(11-12)27-32(30,31-21)17(19)20)25-26-18-24-15(22-4)16(23-5)29(18)8-3/h9-11,17H,6-8H2,1-3H3/b26-25+ |
| InChIKey | VZVZGRSTEPIVSB-OCEACIFDSA-N |
| XLogP | 6.40 |
| TPSA | 93.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.47 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|