C25H28N8S — CID 58059899
4-tert-butyl-5-[(E)-[1-[(4-ethenylphenyl)methyl]-4,5-diisocyanoimidazol-2-yl]diazenyl]-N,N-diethyl-1,3-thiazol-2-amine (PubChem CID 58059899) has the molecular formula C25H28N8S and a molecular weight of 472.62 g/mol. Its IUPAC name is 4-tert-butyl-5-[(E)-[1-[(4-ethenylphenyl)methyl]-4,5-diisocyanoimidazol-2-yl]diazenyl]-N,N-diethyl-1,3-thiazol-2-amine.
| Compound Name | 4-tert-butyl-5-[(E)-[1-[(4-ethenylphenyl)methyl]-4,5-diisocyanoimidazol-2-yl]diazenyl]-N,N-diethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 58059899 |
| Molecular Formula | C25H28N8S |
| Molecular Weight | 472.62 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 4-tert-butyl-5-[(E)-[1-[(4-ethenylphenyl)methyl]-4,5-diisocyanoimidazol-2-yl]diazenyl]-N,N-diethyl-1,3-thiazol-2-amine |
| SMILES | [C-]#[N+]c1nc(/N=N/c2sc(N(CC)CC)nc2C(C)(C)C)n(Cc2ccc(C=C)cc2)c1[N+]#[C-] |
| InChI | InChI=1S/C25H28N8S/c1-9-17-12-14-18(15-13-17)16-33-21(27-8)20(26-7)29-23(33)31-30-22-19(25(4,5)6)28-24(34-22)32(10-2)11-3/h9,12-15H,1,10-11,16H2,2-6H3/b31-30+ |
| InChIKey | PKTYZJAUPWAMAU-NVQSTNCTSA-N |
| XLogP | 7.69 |
| TPSA | 67.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.62 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|