C34H40N8O3S — CID 58059925
1-[(4-butan-2-ylphenyl)methyl]-2-[(E)-[2-(diethylamino)-4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,3-thiazol-5-yl]diazenyl]imidazole-4,5-dicarbonitrile (PubChem CID 58059925) has the molecular formula C34H40N8O3S and a molecular weight of 640.81 g/mol. Its IUPAC name is 1-[(4-butan-2-ylphenyl)methyl]-2-[(E)-[2-(diethylamino)-4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,3-thiazol-5-yl]diazenyl]imidazole-4,5-dicarbonitrile.
| Compound Name | 1-[(4-butan-2-ylphenyl)methyl]-2-[(E)-[2-(diethylamino)-4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,3-thiazol-5-yl]diazenyl]imidazole-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 58059925 |
| Molecular Formula | C34H40N8O3S |
| Molecular Weight | 640.81 g/mol |
| Exact Mass | 640.29 |
| IUPAC Name | 1-[(4-butan-2-ylphenyl)methyl]-2-[(E)-[2-(diethylamino)-4-[4-[2-(2-methoxyethoxy)ethoxy]phenyl]-1,3-thiazol-5-yl]diazenyl]imidazole-4,5-dicarbonitrile |
| SMILES | CCC(C)c1ccc(Cn2c(/N=N/c3sc(N(CC)CC)nc3-c3ccc(OCCOCCOC)cc3)nc(C#N)c2C#N)cc1 |
| InChI | InChI=1S/C34H40N8O3S/c1-6-24(4)26-11-9-25(10-12-26)23-42-30(22-36)29(21-35)37-33(42)40-39-32-31(38-34(46-32)41(7-2)8-3)27-13-15-28(16-14-27)45-20-19-44-18-17-43-5/h9-16,24H,6-8,17-20,23H2,1-5H3/b40-39+ |
| InChIKey | QKNSYGQYJMCYGG-XQQUEIPISA-N |
| XLogP | 7.62 |
| TPSA | 133.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.81 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|