C18H17N9 — CID 135730699
4-[(4,5-diisocyano-1H-imidazol-2-yl)diazenyl]-N-ethyl-N-(4H-imidazol-2-ylmethyl)-3-methylaniline (PubChem CID 135730699) has the molecular formula C18H17N9 and a molecular weight of 359.40 g/mol. Its IUPAC name is 4-[(4,5-diisocyano-1H-imidazol-2-yl)diazenyl]-N-ethyl-N-(4H-imidazol-2-ylmethyl)-3-methylaniline.
| Compound Name | 4-[(4,5-diisocyano-1H-imidazol-2-yl)diazenyl]-N-ethyl-N-(4H-imidazol-2-ylmethyl)-3-methylaniline |
|---|---|
| PubChem CID | 135730699 |
| Molecular Formula | C18H17N9 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-[(4,5-diisocyano-1H-imidazol-2-yl)diazenyl]-N-ethyl-N-(4H-imidazol-2-ylmethyl)-3-methylaniline |
| SMILES | [C-]#[N+]c1nc(/N=N/c2ccc(N(CC)CC3=NCC=N3)cc2C)[nH]c1[N+]#[C-] |
| InChI | InChI=1S/C18H17N9/c1-5-27(11-15-21-8-9-22-15)13-6-7-14(12(2)10-13)25-26-18-23-16(19-3)17(20-4)24-18/h6-8,10H,5,9,11H2,1-2H3,(H,23,24)/b26-25+ |
| InChIKey | PEDKPQJUVXVYHW-OCEACIFDSA-N |
| XLogP | 4.54 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|