About [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen
[4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen (PubChem CID 142561776) has the molecular formula C13H21NO2
and a molecular weight of 223.32 g/mol. Its IUPAC name is [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen.
Analyze [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen?
The IUPAC name of [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen (CID 142561776) is [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen.
What is the SMILES notation for [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen?
The canonical SMILES for [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen is CNc1ccc(COC(=O)C(C)(C)C)cc1.[H][H].
What is the InChIKey of [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen?
The InChIKey is JCKLPHJTCGDGFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2.H2/c1-13(2,3)12(15)16-9-10-5-7-11(14-4)8-6-10;/h5-8,14H,9H2,1-4H3;1H.
What are the key properties of [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen?
[4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen has a molecular weight of 223.32 g/mol, XLogP of 3.06, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(methylamino)phenyl]methyl 2,2-dimethylpropanoate;molecular hydrogen is sourced from PubChem (CID 142561776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).