C15H23NO2S — CID 129076673
[4-(2-sulfanylpropan-2-ylamino)phenyl]methyl 2,2-dimethylpropanoate (PubChem CID 129076673) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is [4-(2-sulfanylpropan-2-ylamino)phenyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [4-(2-sulfanylpropan-2-ylamino)phenyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 129076673 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | [4-(2-sulfanylpropan-2-ylamino)phenyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(S)Nc1ccc(COC(=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23NO2S/c1-14(2,3)13(17)18-10-11-6-8-12(9-7-11)16-15(4,5)19/h6-9,16,19H,10H2,1-5H3 |
| InChIKey | CCFHYMVNKPYIIJ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|