C19H24N2O6 — CID 166497925
[2-methyl-2-[[4-(methylamino)phenyl]methoxycarbonylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 166497925) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is [2-methyl-2-[[4-(methylamino)phenyl]methoxycarbonylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-methyl-2-[[4-(methylamino)phenyl]methoxycarbonylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 166497925 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | [2-methyl-2-[[4-(methylamino)phenyl]methoxycarbonylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)OCc1ccc(NC)cc1 |
| InChI | InChI=1S/C19H24N2O6/c1-5-16(22)26-12-19(3,13-27-17(23)6-2)21-18(24)25-11-14-7-9-15(20-4)10-8-14/h5-10,20H,1-2,11-13H2,3-4H3,(H,21,24) |
| InChIKey | VPXFMSHXCDHMBU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|