C22H23N2O6+ — CID 59705464
[2-methyl-2-[(4-phenylpyridin-1-ium-1-yl)oxycarbonylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 59705464) has the molecular formula C22H23N2O6+ and a molecular weight of 411.43 g/mol. Its IUPAC name is [2-methyl-2-[(4-phenylpyridin-1-ium-1-yl)oxycarbonylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-methyl-2-[(4-phenylpyridin-1-ium-1-yl)oxycarbonylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 59705464 |
| Molecular Formula | C22H23N2O6+ |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | [2-methyl-2-[(4-phenylpyridin-1-ium-1-yl)oxycarbonylamino]-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)(COC(=O)C=C)NC(=O)O[n+]1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22N2O6/c1-4-19(25)28-15-22(3,16-29-20(26)5-2)23-21(27)30-24-13-11-18(12-14-24)17-9-7-6-8-10-17/h4-14H,1-2,15-16H2,3H3/p+1 |
| InChIKey | VNWCVDZDHSYYHD-UHFFFAOYSA-O |
| XLogP | 2.00 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|