C29H31NO9S — CID 167087229
[2-[[4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenoxy]carbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate (PubChem CID 167087229) has the molecular formula C29H31NO9S and a molecular weight of 569.63 g/mol. Its IUPAC name is [2-[[4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenoxy]carbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate.
| Compound Name | [2-[[4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenoxy]carbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
|---|---|
| PubChem CID | 167087229 |
| Molecular Formula | C29H31NO9S |
| Molecular Weight | 569.63 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | [2-[[4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenoxy]carbonylamino]-2-methyl-3-prop-2-enoyloxypropyl] prop-2-enoate |
| SMILES | C=CCc1cc(S(=O)(=O)c2ccc(OC(=O)NC(C)(COC(=O)C=C)COC(=O)C=C)c(CC=C)c2)ccc1O |
| InChI | InChI=1S/C29H31NO9S/c1-6-10-20-16-22(12-14-24(20)31)40(35,36)23-13-15-25(21(17-23)11-7-2)39-28(34)30-29(5,18-37-26(32)8-3)19-38-27(33)9-4/h6-9,12-17,31H,1-4,10-11,18-19H2,5H3,(H,30,34) |
| InChIKey | KYTIMXIGBKBEMP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|