C14H23N3O3 — CID 142474647
ethane;[4-(methylamino)phenyl]methyl N-[2-(methylamino)-2-oxoethyl]carbamate (PubChem CID 142474647) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is ethane;[4-(methylamino)phenyl]methyl N-[2-(methylamino)-2-oxoethyl]carbamate.
| Compound Name | ethane;[4-(methylamino)phenyl]methyl N-[2-(methylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 142474647 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | ethane;[4-(methylamino)phenyl]methyl N-[2-(methylamino)-2-oxoethyl]carbamate |
| SMILES | CC.CNC(=O)CNC(=O)OCc1ccc(NC)cc1 |
| InChI | InChI=1S/C12H17N3O3.C2H6/c1-13-10-5-3-9(4-6-10)8-18-12(17)15-7-11(16)14-2;1-2/h3-6,13H,7-8H2,1-2H3,(H,14,16)(H,15,17);1-2H3 |
| InChIKey | VUTHVBXUYCEICW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |