About (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate
(4-ethylphenyl)methyl 2-amino-6-chlorobenzoate (PubChem CID 63663287) has the molecular formula C16H16ClNO2
and a molecular weight of 289.76 g/mol. Its IUPAC name is (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate.
Molecular Properties
| Compound Name | (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate |
| PubChem CID | 63663287 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate |
| SMILES | CCc1ccc(COC(=O)c2c(N)cccc2Cl)cc1 |
| InChI | InChI=1S/C16H16ClNO2/c1-2-11-6-8-12(9-7-11)10-20-16(19)15-13(17)4-3-5-14(15)18/h3-9H,2,10,18H2,1H3 |
| InChIKey | MUCGOMRMGJEIQS-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate?
The IUPAC name of (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate (CID 63663287) is (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate.
What is the SMILES notation for (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate?
The canonical SMILES for (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate is CCc1ccc(COC(=O)c2c(N)cccc2Cl)cc1.
What is the InChIKey of (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate?
The InChIKey is MUCGOMRMGJEIQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16ClNO2/c1-2-11-6-8-12(9-7-11)10-20-16(19)15-13(17)4-3-5-14(15)18/h3-9H,2,10,18H2,1H3.
What are the key properties of (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate?
(4-ethylphenyl)methyl 2-amino-6-chlorobenzoate has a molecular weight of 289.76 g/mol, XLogP of 3.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl)methyl 2-amino-6-chlorobenzoate is sourced from PubChem (CID 63663287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).