About [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate
[2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate (PubChem CID 63663469) has the molecular formula C13H17ClN2O3
and a molecular weight of 284.74 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate.
Molecular Properties
| Compound Name | [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate |
| PubChem CID | 63663469 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate |
| SMILES | CCCCNC(=O)COC(=O)c1c(N)cccc1Cl |
| InChI | InChI=1S/C13H17ClN2O3/c1-2-3-7-16-11(17)8-19-13(18)12-9(14)5-4-6-10(12)15/h4-6H,2-3,7-8,15H2,1H3,(H,16,17) |
| InChIKey | COPDLODVBVVFCC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate?
The IUPAC name of [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate (CID 63663469) is [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate.
What is the SMILES notation for [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate?
The canonical SMILES for [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate is CCCCNC(=O)COC(=O)c1c(N)cccc1Cl.
What is the InChIKey of [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate?
The InChIKey is COPDLODVBVVFCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O3/c1-2-3-7-16-11(17)8-19-13(18)12-9(14)5-4-6-10(12)15/h4-6H,2-3,7-8,15H2,1H3,(H,16,17).
What are the key properties of [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate?
[2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate has a molecular weight of 284.74 g/mol, XLogP of 2.00, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(butylamino)-2-oxoethyl] 2-amino-6-chlorobenzoate is sourced from PubChem (CID 63663469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).