C21H29NO5S — CID 155716464
4-[(4-methoxyphenyl)methoxy]-2-methylidene-4-oxobutanoic acid;3-methylsulfanyl-3-azabicyclo[3.2.1]octane (PubChem CID 155716464) has the molecular formula C21H29NO5S and a molecular weight of 407.53 g/mol. Its IUPAC name is 4-[(4-methoxyphenyl)methoxy]-2-methylidene-4-oxobutanoic acid;3-methylsulfanyl-3-azabicyclo[3.2.1]octane.
| Compound Name | 4-[(4-methoxyphenyl)methoxy]-2-methylidene-4-oxobutanoic acid;3-methylsulfanyl-3-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 155716464 |
| Molecular Formula | C21H29NO5S |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 4-[(4-methoxyphenyl)methoxy]-2-methylidene-4-oxobutanoic acid;3-methylsulfanyl-3-azabicyclo[3.2.1]octane |
| SMILES | C=C(CC(=O)OCc1ccc(OC)cc1)C(=O)O.CSN1CC2CCC(C2)C1 |
| InChI | InChI=1S/C13H14O5.C8H15NS/c1-9(13(15)16)7-12(14)18-8-10-3-5-11(17-2)6-4-10;1-10-9-5-7-2-3-8(4-7)6-9/h3-6H,1,7-8H2,2H3,(H,15,16);7-8H,2-6H2,1H3 |
| InChIKey | TVPPFEFBMQOYAG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|