C13H17NO4 — CID 90285225
(4-methoxyphenyl)methyl N-cyclopropyl-N-(hydroxymethyl)carbamate (PubChem CID 90285225) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl N-cyclopropyl-N-(hydroxymethyl)carbamate.
| Compound Name | (4-methoxyphenyl)methyl N-cyclopropyl-N-(hydroxymethyl)carbamate |
|---|---|
| PubChem CID | 90285225 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (4-methoxyphenyl)methyl N-cyclopropyl-N-(hydroxymethyl)carbamate |
| SMILES | COc1ccc(COC(=O)N(CO)C2CC2)cc1 |
| InChI | InChI=1S/C13H17NO4/c1-17-12-6-2-10(3-7-12)8-18-13(16)14(9-15)11-4-5-11/h2-3,6-7,11,15H,4-5,8-9H2,1H3 |
| InChIKey | VKHQXJPRHMKUIU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|