C17H21F3N2O5S — CID 166098905
2-(methanesulfonamido)ethyl 2-methylidene-4-oxo-4-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]butanoate (PubChem CID 166098905) has the molecular formula C17H21F3N2O5S and a molecular weight of 422.43 g/mol. Its IUPAC name is 2-(methanesulfonamido)ethyl 2-methylidene-4-oxo-4-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]butanoate.
| Compound Name | 2-(methanesulfonamido)ethyl 2-methylidene-4-oxo-4-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]butanoate |
|---|---|
| PubChem CID | 166098905 |
| Molecular Formula | C17H21F3N2O5S |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-(methanesulfonamido)ethyl 2-methylidene-4-oxo-4-[[(1S)-1-[4-(trifluoromethyl)phenyl]ethyl]amino]butanoate |
| SMILES | C=C(CC(=O)N[C@@H](C)c1ccc(C(F)(F)F)cc1)C(=O)OCCNS(C)(=O)=O |
| InChI | InChI=1S/C17H21F3N2O5S/c1-11(16(24)27-9-8-21-28(3,25)26)10-15(23)22-12(2)13-4-6-14(7-5-13)17(18,19)20/h4-7,12,21H,1,8-10H2,2-3H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | OPRYLSNLKICSHH-LBPRGKRZSA-N |
| XLogP | 1.92 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|