C12H14F5O4- — CID 151487015
3-(5,5,6,6,6-pentafluoro-2-methylhexan-3-yl)oxycarbonylbut-3-enoate (PubChem CID 151487015) has the molecular formula C12H14F5O4- and a molecular weight of 317.23 g/mol. Its IUPAC name is 3-(5,5,6,6,6-pentafluoro-2-methylhexan-3-yl)oxycarbonylbut-3-enoate.
| Compound Name | 3-(5,5,6,6,6-pentafluoro-2-methylhexan-3-yl)oxycarbonylbut-3-enoate |
|---|---|
| PubChem CID | 151487015 |
| Molecular Formula | C12H14F5O4- |
| Molecular Weight | 317.23 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-(5,5,6,6,6-pentafluoro-2-methylhexan-3-yl)oxycarbonylbut-3-enoate |
| SMILES | C=C(CC(=O)[O-])C(=O)OC(CC(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H15F5O4/c1-6(2)8(5-11(13,14)12(15,16)17)21-10(20)7(3)4-9(18)19/h6,8H,3-5H2,1-2H3,(H,18,19)/p-1 |
| InChIKey | PNRCSLORNRMSKJ-UHFFFAOYSA-M |
| XLogP | 1.84 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|