C13H24O2 — CID 156770840
3,4,4-trimethylpentan-2-yl 2-methylidenebutanoate (PubChem CID 156770840) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is 3,4,4-trimethylpentan-2-yl 2-methylidenebutanoate.
| Compound Name | 3,4,4-trimethylpentan-2-yl 2-methylidenebutanoate |
|---|---|
| PubChem CID | 156770840 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | 3,4,4-trimethylpentan-2-yl 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OC(C)C(C)C(C)(C)C |
| InChI | InChI=1S/C13H24O2/c1-8-9(2)12(14)15-11(4)10(3)13(5,6)7/h10-11H,2,8H2,1,3-7H3 |
| InChIKey | ZOPSTGOLKVXSEH-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|