C15H22F6O2 — CID 59217591
[1,1,1-trifluoro-2-methyl-2-(trifluoromethyl)octan-4-yl] 2-methylidenebutanoate (PubChem CID 59217591) has the molecular formula C15H22F6O2 and a molecular weight of 348.33 g/mol. Its IUPAC name is [1,1,1-trifluoro-2-methyl-2-(trifluoromethyl)octan-4-yl] 2-methylidenebutanoate.
| Compound Name | [1,1,1-trifluoro-2-methyl-2-(trifluoromethyl)octan-4-yl] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 59217591 |
| Molecular Formula | C15H22F6O2 |
| Molecular Weight | 348.33 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [1,1,1-trifluoro-2-methyl-2-(trifluoromethyl)octan-4-yl] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)OC(CCCC)CC(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H22F6O2/c1-5-7-8-11(23-12(22)10(3)6-2)9-13(4,14(16,17)18)15(19,20)21/h11H,3,5-9H2,1-2,4H3 |
| InChIKey | IBFIYUSZKCJDAX-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.33 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|